About [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol
[4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol (PubChem CID 120971771) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol.
Molecular Properties
| Compound Name | [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol |
| PubChem CID | 120971771 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol |
| SMILES | CC1CN=C(NCC2(CO)CCOCC2)N1 |
| InChI | InChI=1S/C11H21N3O2/c1-9-6-12-10(14-9)13-7-11(8-15)2-4-16-5-3-11/h9,15H,2-8H2,1H3,(H2,12,13,14) |
| InChIKey | OCBHJAGFPMOHIA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol?
The IUPAC name of [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol (CID 120971771) is [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol.
What is the SMILES notation for [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol?
The canonical SMILES for [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol is CC1CN=C(NCC2(CO)CCOCC2)N1.
What is the InChIKey of [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol?
The InChIKey is OCBHJAGFPMOHIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-9-6-12-10(14-9)13-7-11(8-15)2-4-16-5-3-11/h9,15H,2-8H2,1H3,(H2,12,13,14).
What are the key properties of [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol?
[4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol has a molecular weight of 227.31 g/mol, XLogP of -0.29, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol is sourced from PubChem (CID 120971771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).