About 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide
2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide (PubChem CID 120972076) has the molecular formula C10H16IN5O
and a molecular weight of 349.18 g/mol. Its IUPAC name is 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide.
Molecular Properties
| Compound Name | 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide |
| PubChem CID | 120972076 |
| Molecular Formula | C10H16IN5O |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide |
| SMILES | Cc1ncc(CNC2=NCC(C)N2)c(=O)[nH]1.I |
| InChI | InChI=1S/C10H15N5O.HI/c1-6-3-12-10(14-6)13-5-8-4-11-7(2)15-9(8)16;/h4,6H,3,5H2,1-2H3,(H,11,15,16)(H2,12,13,14);1H |
| InChIKey | PCDGJWPREMCJRQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide?
The IUPAC name of 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide (CID 120972076) is 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide.
What is the SMILES notation for 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide?
The canonical SMILES for 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide is Cc1ncc(CNC2=NCC(C)N2)c(=O)[nH]1.I.
What is the InChIKey of 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide?
The InChIKey is PCDGJWPREMCJRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O.HI/c1-6-3-12-10(14-6)13-5-8-4-11-7(2)15-9(8)16;/h4,6H,3,5H2,1-2H3,(H,11,15,16)(H2,12,13,14);1H.
What are the key properties of 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide?
2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide has a molecular weight of 349.18 g/mol, XLogP of 0.13, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]-1H-pyrimidin-6-one;hydroiodide is sourced from PubChem (CID 120972076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).