C10H16IN3O2S2 — CID 120972348
1-methyl-N-[(5-methylsulfonylthiophen-2-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120972348) has the molecular formula C10H16IN3O2S2 and a molecular weight of 401.30 g/mol. Its IUPAC name is 1-methyl-N-[(5-methylsulfonylthiophen-2-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | 1-methyl-N-[(5-methylsulfonylthiophen-2-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120972348 |
| Molecular Formula | C10H16IN3O2S2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 1-methyl-N-[(5-methylsulfonylthiophen-2-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NCc1ccc(S(C)(=O)=O)s1.I |
| InChI | InChI=1S/C10H15N3O2S2.HI/c1-13-6-5-11-10(13)12-7-8-3-4-9(16-8)17(2,14)15;/h3-4H,5-7H2,1-2H3,(H,11,12);1H |
| InChIKey | SKQSGPBLHOKCME-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|