C13H16F2IN3 — CID 120972624
N-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120972624) has the molecular formula C13H16F2IN3 and a molecular weight of 379.19 g/mol. Its IUPAC name is N-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120972624 |
| Molecular Formula | C13H16F2IN3 |
| Molecular Weight | 379.19 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1N[C@@H]1C[C@H]1c1c(F)cccc1F.I |
| InChI | InChI=1S/C13H15F2N3.HI/c1-18-6-5-16-13(18)17-11-7-8(11)12-9(14)3-2-4-10(12)15;/h2-4,8,11H,5-7H2,1H3,(H,16,17);1H/t8-,11-;/m1./s1 |
| InChIKey | UEILUADXIQMNRV-JHQAJZDGSA-N |
| XLogP | 2.33 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|