C16H30N6 — CID 120972925
1,1,3,3-tetramethyl-2-[[(2R,3S)-1-methyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methyl]guanidine (PubChem CID 120972925) has the molecular formula C16H30N6 and a molecular weight of 306.46 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[[(2R,3S)-1-methyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[[(2R,3S)-1-methyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 120972925 |
| Molecular Formula | C16H30N6 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[[(2R,3S)-1-methyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methyl]guanidine |
| SMILES | CN(C)C(=NC[C@@H]1CCCN(C)[C@H]1c1ccnn1C)N(C)C |
| InChI | InChI=1S/C16H30N6/c1-19(2)16(20(3)4)17-12-13-8-7-11-21(5)15(13)14-9-10-18-22(14)6/h9-10,13,15H,7-8,11-12H2,1-6H3/t13-,15+/m0/s1 |
| InChIKey | RRQLVKIAPSTTTB-DZGCQCFKSA-N |
| XLogP | 1.28 |
| TPSA | 39.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|