C11H19F3IN3 — CID 120973282
1-cyclopentyl-2-[[1-(trifluoromethyl)cyclopropyl]methyl]guanidine;hydroiodide (PubChem CID 120973282) has the molecular formula C11H19F3IN3 and a molecular weight of 377.19 g/mol. Its IUPAC name is 1-cyclopentyl-2-[[1-(trifluoromethyl)cyclopropyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-[[1-(trifluoromethyl)cyclopropyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120973282 |
| Molecular Formula | C11H19F3IN3 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 1-cyclopentyl-2-[[1-(trifluoromethyl)cyclopropyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1(C(F)(F)F)CC1)NC1CCCC1 |
| InChI | InChI=1S/C11H18F3N3.HI/c12-11(13,14)10(5-6-10)7-16-9(15)17-8-3-1-2-4-8;/h8H,1-7H2,(H3,15,16,17);1H |
| InChIKey | XHWXFZITTUIPCR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|