C10H17N7 — CID 120973357
2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,1-diethylguanidine (PubChem CID 120973357) has the molecular formula C10H17N7 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,1-diethylguanidine.
| Compound Name | 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 120973357 |
| Molecular Formula | C10H17N7 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CCn1cnc(C#N)n1 |
| InChI | InChI=1S/C10H17N7/c1-3-16(4-2)10(12)13-5-6-17-8-14-9(7-11)15-17/h8H,3-6H2,1-2H3,(H2,12,13) |
| InChIKey | KPCOODJRXOCYBR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 96.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|