C15H23ClN4O3S — CID 120973631
1-(3-chloro-4-methoxyphenyl)-2-[(1-methylsulfonylpiperidin-2-yl)methyl]guanidine (PubChem CID 120973631) has the molecular formula C15H23ClN4O3S and a molecular weight of 374.89 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[(1-methylsulfonylpiperidin-2-yl)methyl]guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[(1-methylsulfonylpiperidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 120973631 |
| Molecular Formula | C15H23ClN4O3S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[(1-methylsulfonylpiperidin-2-yl)methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC2CCCCN2S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C15H23ClN4O3S/c1-23-14-7-6-11(9-13(14)16)19-15(17)18-10-12-5-3-4-8-20(12)24(2,21)22/h6-7,9,12H,3-5,8,10H2,1-2H3,(H3,17,18,19) |
| InChIKey | FBIGZTYPQBTYRR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|