C14H26F3IN4O — CID 120973862
1-cyclohexyl-2-(3,3,3-trifluoro-2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 120973862) has the molecular formula C14H26F3IN4O and a molecular weight of 450.29 g/mol. Its IUPAC name is 1-cyclohexyl-2-(3,3,3-trifluoro-2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-2-(3,3,3-trifluoro-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120973862 |
| Molecular Formula | C14H26F3IN4O |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 1-cyclohexyl-2-(3,3,3-trifluoro-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC(N1CCOCC1)C(F)(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C14H25F3N4O.HI/c15-14(16,17)12(21-6-8-22-9-7-21)10-19-13(18)20-11-4-2-1-3-5-11;/h11-12H,1-10H2,(H3,18,19,20);1H |
| InChIKey | CYHQFGBHONFKGW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|