C20H25ClN2O4 — CID 120977777
2-(4-chlorophenyl)-2-[[1-(cyclopropanecarbonyl)piperidine-3-carbonyl]amino]butanoic acid (PubChem CID 120977777) has the molecular formula C20H25ClN2O4 and a molecular weight of 392.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[[1-(cyclopropanecarbonyl)piperidine-3-carbonyl]amino]butanoic acid.
| Compound Name | 2-(4-chlorophenyl)-2-[[1-(cyclopropanecarbonyl)piperidine-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120977777 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[[1-(cyclopropanecarbonyl)piperidine-3-carbonyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)C1CCCN(C(=O)C2CC2)C1)(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H25ClN2O4/c1-2-20(19(26)27,15-7-9-16(21)10-8-15)22-17(24)14-4-3-11-23(12-14)18(25)13-5-6-13/h7-10,13-14H,2-6,11-12H2,1H3,(H,22,24)(H,26,27) |
| InChIKey | UTFTWILCJDVGRM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |