C18H18N2O5 — CID 120979125
(3R,4R)-4-cyclopropyl-1-[2-(1,3-dioxoisoindol-2-yl)acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 120979125) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is (3R,4R)-4-cyclopropyl-1-[2-(1,3-dioxoisoindol-2-yl)acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-cyclopropyl-1-[2-(1,3-dioxoisoindol-2-yl)acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120979125 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (3R,4R)-4-cyclopropyl-1-[2-(1,3-dioxoisoindol-2-yl)acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)CN2C(=O)c3ccccc3C2=O)C[C@@H]1C1CC1 |
| InChI | InChI=1S/C18H18N2O5/c21-15(19-7-13(10-5-6-10)14(8-19)18(24)25)9-20-16(22)11-3-1-2-4-12(11)17(20)23/h1-4,10,13-14H,5-9H2,(H,24,25)/t13-,14+/m1/s1 |
| InChIKey | RHHYLCRIWPXWDF-KGLIPLIRSA-N |
| XLogP | 0.85 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|