C16H23FN4O2 — CID 120980407
N-(3-fluorophenyl)-2-[methyl-(3-oxo-3-piperazin-1-ylpropyl)amino]acetamide (PubChem CID 120980407) has the molecular formula C16H23FN4O2 and a molecular weight of 322.38 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[methyl-(3-oxo-3-piperazin-1-ylpropyl)amino]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[methyl-(3-oxo-3-piperazin-1-ylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 120980407 |
| Molecular Formula | C16H23FN4O2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-(3-fluorophenyl)-2-[methyl-(3-oxo-3-piperazin-1-ylpropyl)amino]acetamide |
| SMILES | CN(CCC(=O)N1CCNCC1)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H23FN4O2/c1-20(8-5-16(23)21-9-6-18-7-10-21)12-15(22)19-14-4-2-3-13(17)11-14/h2-4,11,18H,5-10,12H2,1H3,(H,19,22) |
| InChIKey | KXVGLMABPGIMQM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |