C19H32ClN3O — CID 120980972
3-[2-methylpropyl(2-phenylethyl)amino]-1-piperazin-1-ylpropan-1-one;hydrochloride (PubChem CID 120980972) has the molecular formula C19H32ClN3O and a molecular weight of 353.94 g/mol. Its IUPAC name is 3-[2-methylpropyl(2-phenylethyl)amino]-1-piperazin-1-ylpropan-1-one;hydrochloride.
| Compound Name | 3-[2-methylpropyl(2-phenylethyl)amino]-1-piperazin-1-ylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120980972 |
| Molecular Formula | C19H32ClN3O |
| Molecular Weight | 353.94 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 3-[2-methylpropyl(2-phenylethyl)amino]-1-piperazin-1-ylpropan-1-one;hydrochloride |
| SMILES | CC(C)CN(CCC(=O)N1CCNCC1)CCc1ccccc1.Cl |
| InChI | InChI=1S/C19H31N3O.ClH/c1-17(2)16-21(12-8-18-6-4-3-5-7-18)13-9-19(23)22-14-10-20-11-15-22;/h3-7,17,20H,8-16H2,1-2H3;1H |
| InChIKey | UMNQIVICASBDFF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.94 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |