C13H25ClN4O2 — CID 120981528
3-ethyl-4-(3-oxo-3-piperazin-1-ylpropyl)piperazin-2-one;hydrochloride (PubChem CID 120981528) has the molecular formula C13H25ClN4O2 and a molecular weight of 304.82 g/mol. Its IUPAC name is 3-ethyl-4-(3-oxo-3-piperazin-1-ylpropyl)piperazin-2-one;hydrochloride.
| Compound Name | 3-ethyl-4-(3-oxo-3-piperazin-1-ylpropyl)piperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120981528 |
| Molecular Formula | C13H25ClN4O2 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-ethyl-4-(3-oxo-3-piperazin-1-ylpropyl)piperazin-2-one;hydrochloride |
| SMILES | CCC1C(=O)NCCN1CCC(=O)N1CCNCC1.Cl |
| InChI | InChI=1S/C13H24N4O2.ClH/c1-2-11-13(19)15-6-10-16(11)7-3-12(18)17-8-4-14-5-9-17;/h11,14H,2-10H2,1H3,(H,15,19);1H |
| InChIKey | VMIYACHLXHALAT-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |