C17H33ClN4O2 — CID 120982240
1-[(3-oxo-3-piperazin-1-ylpropyl)amino]-N-propylcyclohexane-1-carboxamide;hydrochloride (PubChem CID 120982240) has the molecular formula C17H33ClN4O2 and a molecular weight of 360.93 g/mol. Its IUPAC name is 1-[(3-oxo-3-piperazin-1-ylpropyl)amino]-N-propylcyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-[(3-oxo-3-piperazin-1-ylpropyl)amino]-N-propylcyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120982240 |
| Molecular Formula | C17H33ClN4O2 |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-[(3-oxo-3-piperazin-1-ylpropyl)amino]-N-propylcyclohexane-1-carboxamide;hydrochloride |
| SMILES | CCCNC(=O)C1(NCCC(=O)N2CCNCC2)CCCCC1.Cl |
| InChI | InChI=1S/C17H32N4O2.ClH/c1-2-9-19-16(23)17(7-4-3-5-8-17)20-10-6-15(22)21-13-11-18-12-14-21;/h18,20H,2-14H2,1H3,(H,19,23);1H |
| InChIKey | AHYPWLIJNDSIEY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |