C17H32N4O2 — CID 120982439
3-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one (PubChem CID 120982439) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 120982439 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 3-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one |
| SMILES | O=C(CCN1CCC(CN2CCOCC2)CC1)N1CCNCC1 |
| InChI | InChI=1S/C17H32N4O2/c22-17(21-9-4-18-5-10-21)3-8-19-6-1-16(2-7-19)15-20-11-13-23-14-12-20/h16,18H,1-15H2 |
| InChIKey | WJQZOOZWXMJLLP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |