C17H36Cl2N4O — CID 120982442
3-[4-(diethylaminomethyl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one;dihydrochloride (PubChem CID 120982442) has the molecular formula C17H36Cl2N4O and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-[4-(diethylaminomethyl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one;dihydrochloride.
| Compound Name | 3-[4-(diethylaminomethyl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120982442 |
| Molecular Formula | C17H36Cl2N4O |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3-[4-(diethylaminomethyl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one;dihydrochloride |
| SMILES | CCN(CC)CC1CCN(CCC(=O)N2CCNCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C17H34N4O.2ClH/c1-3-19(4-2)15-16-5-10-20(11-6-16)12-7-17(22)21-13-8-18-9-14-21;;/h16,18H,3-15H2,1-2H3;2*1H |
| InChIKey | WFMJMCDYGBCPMZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |