C18H26ClFN4O — CID 120982448
3-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-1-piperazin-1-ylpropan-1-one (PubChem CID 120982448) has the molecular formula C18H26ClFN4O and a molecular weight of 368.88 g/mol. Its IUPAC name is 3-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 120982448 |
| Molecular Formula | C18H26ClFN4O |
| Molecular Weight | 368.88 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-1-piperazin-1-ylpropan-1-one |
| SMILES | O=C(CCN1CCN(Cc2ccc(F)cc2Cl)CC1)N1CCNCC1 |
| InChI | InChI=1S/C18H26ClFN4O/c19-17-13-16(20)2-1-15(17)14-23-11-9-22(10-12-23)6-3-18(25)24-7-4-21-5-8-24/h1-2,13,21H,3-12,14H2 |
| InChIKey | BFQIVHDUHFXCND-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.88 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |