C15H27ClN2OS — CID 120983130
9-amino-N-methyl-N-(thiolan-3-yl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride (PubChem CID 120983130) has the molecular formula C15H27ClN2OS and a molecular weight of 318.91 g/mol. Its IUPAC name is 9-amino-N-methyl-N-(thiolan-3-yl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride.
| Compound Name | 9-amino-N-methyl-N-(thiolan-3-yl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120983130 |
| Molecular Formula | C15H27ClN2OS |
| Molecular Weight | 318.91 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 9-amino-N-methyl-N-(thiolan-3-yl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
| SMILES | CN(C(=O)C1CC2CCCC(C1)C2N)C1CCSC1.Cl |
| InChI | InChI=1S/C15H26N2OS.ClH/c1-17(13-5-6-19-9-13)15(18)12-7-10-3-2-4-11(8-12)14(10)16;/h10-14H,2-9,16H2,1H3;1H |
| InChIKey | COEWLXYGPHSSGP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.91 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |