C22H31N3O2 — CID 120985547
9-amino-N-[[3-(cyclobutanecarbonylamino)phenyl]methyl]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120985547) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 9-amino-N-[[3-(cyclobutanecarbonylamino)phenyl]methyl]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-[[3-(cyclobutanecarbonylamino)phenyl]methyl]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120985547 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 9-amino-N-[[3-(cyclobutanecarbonylamino)phenyl]methyl]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | NC1C2CCCC1CC(C(=O)NCc1cccc(NC(=O)C3CCC3)c1)C2 |
| InChI | InChI=1S/C22H31N3O2/c23-20-16-7-3-8-17(20)12-18(11-16)21(26)24-13-14-4-1-9-19(10-14)25-22(27)15-5-2-6-15/h1,4,9-10,15-18,20H,2-3,5-8,11-13,23H2,(H,24,26)(H,25,27) |
| InChIKey | DODRJJGYMIRXDQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |