C20H30N2O2 — CID 120986147
9-amino-N-[2-(2,6-dimethylphenoxy)ethyl]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120986147) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 9-amino-N-[2-(2,6-dimethylphenoxy)ethyl]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-[2-(2,6-dimethylphenoxy)ethyl]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120986147 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 9-amino-N-[2-(2,6-dimethylphenoxy)ethyl]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | Cc1cccc(C)c1OCCNC(=O)C1CC2CCCC(C1)C2N |
| InChI | InChI=1S/C20H30N2O2/c1-13-5-3-6-14(2)19(13)24-10-9-22-20(23)17-11-15-7-4-8-16(12-17)18(15)21/h3,5-6,15-18H,4,7-12,21H2,1-2H3,(H,22,23) |
| InChIKey | GTULWPOAMUQENG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|