C15H21N3O4 — CID 120988456
2-amino-1-[4-(3-hydroxybenzoyl)piperazin-1-yl]-3-methoxypropan-1-one (PubChem CID 120988456) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-amino-1-[4-(3-hydroxybenzoyl)piperazin-1-yl]-3-methoxypropan-1-one.
| Compound Name | 2-amino-1-[4-(3-hydroxybenzoyl)piperazin-1-yl]-3-methoxypropan-1-one |
|---|---|
| PubChem CID | 120988456 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-amino-1-[4-(3-hydroxybenzoyl)piperazin-1-yl]-3-methoxypropan-1-one |
| SMILES | COCC(N)C(=O)N1CCN(C(=O)c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C15H21N3O4/c1-22-10-13(16)15(21)18-7-5-17(6-8-18)14(20)11-3-2-4-12(19)9-11/h2-4,9,13,19H,5-8,10,16H2,1H3 |
| InChIKey | WAHWJHZFLNNCSD-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |