C20H29ClN2O2 — CID 120989577
9-amino-N-[(2-prop-2-enoxyphenyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride (PubChem CID 120989577) has the molecular formula C20H29ClN2O2 and a molecular weight of 364.92 g/mol. Its IUPAC name is 9-amino-N-[(2-prop-2-enoxyphenyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride.
| Compound Name | 9-amino-N-[(2-prop-2-enoxyphenyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120989577 |
| Molecular Formula | C20H29ClN2O2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 9-amino-N-[(2-prop-2-enoxyphenyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
| SMILES | C=CCOc1ccccc1CNC(=O)C1CC2CCCC(C1)C2N.Cl |
| InChI | InChI=1S/C20H28N2O2.ClH/c1-2-10-24-18-9-4-3-6-16(18)13-22-20(23)17-11-14-7-5-8-15(12-17)19(14)21;/h2-4,6,9,14-15,17,19H,1,5,7-8,10-13,21H2,(H,22,23);1H |
| InChIKey | HHLHQMHVMPSTOA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|