C20H27F3N2O — CID 120989623
9-amino-N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120989623) has the molecular formula C20H27F3N2O and a molecular weight of 368.44 g/mol. Its IUPAC name is 9-amino-N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120989623 |
| Molecular Formula | C20H27F3N2O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 9-amino-N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CC(Cc1ccc(C(F)(F)F)cc1)NC(=O)C1CC2CCCC(C1)C2N |
| InChI | InChI=1S/C20H27F3N2O/c1-12(9-13-5-7-17(8-6-13)20(21,22)23)25-19(26)16-10-14-3-2-4-15(11-16)18(14)24/h5-8,12,14-16,18H,2-4,9-11,24H2,1H3,(H,25,26) |
| InChIKey | HOZSWSVMHJMCFX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |