C12H21N5O2 — CID 120989967
2-amino-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-methoxypropanamide (PubChem CID 120989967) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-amino-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-methoxypropanamide.
| Compound Name | 2-amino-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 120989967 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-amino-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-methoxypropanamide |
| SMILES | CCc1nc2n(n1)CC(NC(=O)C(N)COC)CC2 |
| InChI | InChI=1S/C12H21N5O2/c1-3-10-15-11-5-4-8(6-17(11)16-10)14-12(18)9(13)7-19-2/h8-9H,3-7,13H2,1-2H3,(H,14,18) |
| InChIKey | BQRSPIYOMZGHCZ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |