C11H16F3N5O2 — CID 120990408
2-amino-3-methoxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]propanamide (PubChem CID 120990408) has the molecular formula C11H16F3N5O2 and a molecular weight of 307.28 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]propanamide.
| Compound Name | 2-amino-3-methoxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 120990408 |
| Molecular Formula | C11H16F3N5O2 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-amino-3-methoxy-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]propanamide |
| SMILES | COCC(N)C(=O)NCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N5O2/c1-21-6-7(15)9(20)16-4-5-18-10-17-3-2-8(19-10)11(12,13)14/h2-3,7H,4-6,15H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | GDAZWACXWXCFPS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|