C19H25ClN2O3 — CID 120990600
2-amino-3-methoxy-N-(1-phenyl-2-phenylmethoxyethyl)propanamide;hydrochloride (PubChem CID 120990600) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-(1-phenyl-2-phenylmethoxyethyl)propanamide;hydrochloride.
| Compound Name | 2-amino-3-methoxy-N-(1-phenyl-2-phenylmethoxyethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120990600 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-amino-3-methoxy-N-(1-phenyl-2-phenylmethoxyethyl)propanamide;hydrochloride |
| SMILES | COCC(N)C(=O)NC(COCc1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H24N2O3.ClH/c1-23-13-17(20)19(22)21-18(16-10-6-3-7-11-16)14-24-12-15-8-4-2-5-9-15;/h2-11,17-18H,12-14,20H2,1H3,(H,21,22);1H |
| InChIKey | NWPLCNTZEVXNKE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |