About 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride
2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride (PubChem CID 120992010) has the molecular formula C9H16ClN3O2S
and a molecular weight of 265.77 g/mol. Its IUPAC name is 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride |
| PubChem CID | 120992010 |
| Molecular Formula | C9H16ClN3O2S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride |
| SMILES | COCC(N)C(=O)Nc1sc(C)nc1C.Cl |
| InChI | InChI=1S/C9H15N3O2S.ClH/c1-5-9(15-6(2)11-5)12-8(13)7(10)4-14-3;/h7H,4,10H2,1-3H3,(H,12,13);1H |
| InChIKey | YOVNUYCOQPSXCV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride?
The IUPAC name of 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride (CID 120992010) is 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride.
What is the SMILES notation for 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride?
The canonical SMILES for 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride is COCC(N)C(=O)Nc1sc(C)nc1C.Cl.
What is the InChIKey of 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride?
The InChIKey is YOVNUYCOQPSXCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S.ClH/c1-5-9(15-6(2)11-5)12-8(13)7(10)4-14-3;/h7H,4,10H2,1-3H3,(H,12,13);1H.
What are the key properties of 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride?
2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride has a molecular weight of 265.77 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,4-dimethyl-1,3-thiazol-5-yl)-3-methoxypropanamide;hydrochloride is sourced from PubChem (CID 120992010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).