C16H27N3O2 — CID 120994182
9-amino-N-[2-(cyclopropylmethylamino)-2-oxoethyl]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120994182) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 9-amino-N-[2-(cyclopropylmethylamino)-2-oxoethyl]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-[2-(cyclopropylmethylamino)-2-oxoethyl]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120994182 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 9-amino-N-[2-(cyclopropylmethylamino)-2-oxoethyl]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | NC1C2CCCC1CC(C(=O)NCC(=O)NCC1CC1)C2 |
| InChI | InChI=1S/C16H27N3O2/c17-15-11-2-1-3-12(15)7-13(6-11)16(21)19-9-14(20)18-8-10-4-5-10/h10-13,15H,1-9,17H2,(H,18,20)(H,19,21) |
| InChIKey | IYGVWNYQTWCSBC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |