C19H25N5O — CID 120995115
(5-methyl-1-phenylpyrazol-4-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone (PubChem CID 120995115) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is (5-methyl-1-phenylpyrazol-4-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone.
| Compound Name | (5-methyl-1-phenylpyrazol-4-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 120995115 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (5-methyl-1-phenylpyrazol-4-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCC(N3CCNCC3)C2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C19H25N5O/c1-15-18(13-21-24(15)16-5-3-2-4-6-16)19(25)23-10-7-17(14-23)22-11-8-20-9-12-22/h2-6,13,17,20H,7-12,14H2,1H3 |
| InChIKey | DSJYKLYFADYWEK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |