C17H22N4O3 — CID 120996295
8-(3-piperazin-1-ylpyrrolidine-1-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 120996295) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 8-(3-piperazin-1-ylpyrrolidine-1-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-(3-piperazin-1-ylpyrrolidine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 120996295 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 8-(3-piperazin-1-ylpyrrolidine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2c(cccc2C(=O)N2CCC(N3CCNCC3)C2)N1 |
| InChI | InChI=1S/C17H22N4O3/c22-15-11-24-16-13(2-1-3-14(16)19-15)17(23)21-7-4-12(10-21)20-8-5-18-6-9-20/h1-3,12,18H,4-11H2,(H,19,22) |
| InChIKey | NUWAGTLVMWTANG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |