C15H21N3O4 — CID 120996909
methyl 5-(3-piperazin-1-ylpyrrolidine-1-carbonyl)furan-2-carboxylate (PubChem CID 120996909) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl 5-(3-piperazin-1-ylpyrrolidine-1-carbonyl)furan-2-carboxylate.
| Compound Name | methyl 5-(3-piperazin-1-ylpyrrolidine-1-carbonyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 120996909 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | methyl 5-(3-piperazin-1-ylpyrrolidine-1-carbonyl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCC(N3CCNCC3)C2)o1 |
| InChI | InChI=1S/C15H21N3O4/c1-21-15(20)13-3-2-12(22-13)14(19)18-7-4-11(10-18)17-8-5-16-6-9-17/h2-3,11,16H,4-10H2,1H3 |
| InChIKey | LFVOERRETBDECI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |