C18H24ClN3O — CID 120997781
[2-(2-chlorophenyl)cyclopropyl]-(3-piperazin-1-ylpyrrolidin-1-yl)methanone (PubChem CID 120997781) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is [2-(2-chlorophenyl)cyclopropyl]-(3-piperazin-1-ylpyrrolidin-1-yl)methanone.
| Compound Name | [2-(2-chlorophenyl)cyclopropyl]-(3-piperazin-1-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 120997781 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [2-(2-chlorophenyl)cyclopropyl]-(3-piperazin-1-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(C1CC1c1ccccc1Cl)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C18H24ClN3O/c19-17-4-2-1-3-14(17)15-11-16(15)18(23)22-8-5-13(12-22)21-9-6-20-7-10-21/h1-4,13,15-16,20H,5-12H2 |
| InChIKey | ZOVYDNOXNCVGCK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |