C16H22FN3O2 — CID 120997837
2-(4-fluorophenoxy)-1-(3-piperazin-1-ylpyrrolidin-1-yl)ethanone (PubChem CID 120997837) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-1-(3-piperazin-1-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(4-fluorophenoxy)-1-(3-piperazin-1-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 120997837 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-(4-fluorophenoxy)-1-(3-piperazin-1-ylpyrrolidin-1-yl)ethanone |
| SMILES | O=C(COc1ccc(F)cc1)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C16H22FN3O2/c17-13-1-3-15(4-2-13)22-12-16(21)20-8-5-14(11-20)19-9-6-18-7-10-19/h1-4,14,18H,5-12H2 |
| InChIKey | LOFXGLUMJAIEOY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |