C19H28ClN3O3 — CID 120998089
(3-chloro-5-methoxy-4-propoxyphenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone (PubChem CID 120998089) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is (3-chloro-5-methoxy-4-propoxyphenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone.
| Compound Name | (3-chloro-5-methoxy-4-propoxyphenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 120998089 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (3-chloro-5-methoxy-4-propoxyphenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone |
| SMILES | CCCOc1c(Cl)cc(C(=O)N2CCC(N3CCNCC3)C2)cc1OC |
| InChI | InChI=1S/C19H28ClN3O3/c1-3-10-26-18-16(20)11-14(12-17(18)25-2)19(24)23-7-4-15(13-23)22-8-5-21-6-9-22/h11-12,15,21H,3-10,13H2,1-2H3 |
| InChIKey | ROEUXNWLSWKLSU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |