About 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide
2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 120998421) has the molecular formula C15H20N4OS2
and a molecular weight of 336.49 g/mol. Its IUPAC name is 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 120998421 |
| Molecular Formula | C15H20N4OS2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCc1nc(CC(=O)Nc2ncc(C3CCNCC3)s2)cs1 |
| InChI | InChI=1S/C15H20N4OS2/c1-2-14-18-11(9-21-14)7-13(20)19-15-17-8-12(22-15)10-3-5-16-6-4-10/h8-10,16H,2-7H2,1H3,(H,17,19,20) |
| InChIKey | ADEKVVMKFSVDAG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide (CID 120998421) is 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide is CCc1nc(CC(=O)Nc2ncc(C3CCNCC3)s2)cs1.
What is the InChIKey of 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide?
The InChIKey is ADEKVVMKFSVDAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4OS2/c1-2-14-18-11(9-21-14)7-13(20)19-15-17-8-12(22-15)10-3-5-16-6-4-10/h8-10,16H,2-7H2,1H3,(H,17,19,20).
What are the key properties of 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide?
2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide has a molecular weight of 336.49 g/mol, XLogP of 2.81, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-1,3-thiazol-4-yl)-N-(5-piperidin-4-yl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 120998421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).