About 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride
1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride (PubChem CID 120999360) has the molecular formula C13H18ClF3N2O2S
and a molecular weight of 358.81 g/mol. Its IUPAC name is 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride |
| PubChem CID | 120999360 |
| Molecular Formula | C13H18ClF3N2O2S |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride |
| SMILES | Cc1cc(C(F)(F)F)ccc1S(=O)(=O)N1CCCNCC1.Cl |
| InChI | InChI=1S/C13H17F3N2O2S.ClH/c1-10-9-11(13(14,15)16)3-4-12(10)21(19,20)18-7-2-5-17-6-8-18;/h3-4,9,17H,2,5-8H2,1H3;1H |
| InChIKey | WUNVWJWQRLGKEG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride?
The IUPAC name of 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride (CID 120999360) is 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride.
What is the SMILES notation for 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride?
The canonical SMILES for 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride is Cc1cc(C(F)(F)F)ccc1S(=O)(=O)N1CCCNCC1.Cl.
What is the InChIKey of 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride?
The InChIKey is WUNVWJWQRLGKEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N2O2S.ClH/c1-10-9-11(13(14,15)16)3-4-12(10)21(19,20)18-7-2-5-17-6-8-18;/h3-4,9,17H,2,5-8H2,1H3;1H.
What are the key properties of 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride?
1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride has a molecular weight of 358.81 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-methyl-4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepane;hydrochloride is sourced from PubChem (CID 120999360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).