C18H15F3N4O3 — CID 121000079
5-[2-methyl-1-[(3-methyl-4-pyridinyl)methyl]-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 121000079) has the molecular formula C18H15F3N4O3 and a molecular weight of 392.34 g/mol. Its IUPAC name is 5-[2-methyl-1-[(3-methyl-4-pyridinyl)methyl]-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[2-methyl-1-[(3-methyl-4-pyridinyl)methyl]-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 121000079 |
| Molecular Formula | C18H15F3N4O3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 5-[2-methyl-1-[(3-methyl-4-pyridinyl)methyl]-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1=CC(=C2C(=O)NC(=O)NC2=O)C=C(C(F)(F)F)N1Cc1ccncc1C |
| InChI | InChI=1S/C18H15F3N4O3/c1-9-7-22-4-3-11(9)8-25-10(2)5-12(6-13(25)18(19,20)21)14-15(26)23-17(28)24-16(14)27/h3-7H,8H2,1-2H3,(H2,23,24,26,27,28) |
| InChIKey | XLACDAHMZIBUQP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|