benzyl 2-(1-nitrocyclopropyl)acetate

C12H13NO4 — CID 121000461

IUPACbenzyl 2-(1-nitrocyclopropyl)acetate
SMILESO=C(CC1([N+](=O)[O-])CC1)OCc1ccccc1
InChIInChI=1S/C12H13NO4/c14-11(8-12(6-7-12)13(15)16)17-9-10-4-2-1-3-5-10/h1-5H,6-9H2
InChIKeyVXIQTMOPSSOESK-UHFFFAOYSA-N
MW235.24 g/mol
LogP1.93
Rot. Bonds5

About benzyl 2-(1-nitrocyclopropyl)acetate

benzyl 2-(1-nitrocyclopropyl)acetate (PubChem CID 121000461) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is benzyl 2-(1-nitrocyclopropyl)acetate.

Molecular Properties

Compound Namebenzyl 2-(1-nitrocyclopropyl)acetate
PubChem CID121000461
Molecular FormulaC12H13NO4
Molecular Weight235.24 g/mol
Exact Mass235.08
IUPAC Namebenzyl 2-(1-nitrocyclopropyl)acetate
SMILESO=C(CC1([N+](=O)[O-])CC1)OCc1ccccc1
InChIInChI=1S/C12H13NO4/c14-11(8-12(6-7-12)13(15)16)17-9-10-4-2-1-3-5-10/h1-5H,6-9H2
InChIKeyVXIQTMOPSSOESK-UHFFFAOYSA-N
XLogP1.93
TPSA69.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.24
LogP ≤ 51.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze benzyl 2-(1-nitrocyclopropyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-(1-nitrocyclopropyl)acetate?
The IUPAC name of benzyl 2-(1-nitrocyclopropyl)acetate (CID 121000461) is benzyl 2-(1-nitrocyclopropyl)acetate.
What is the SMILES notation for benzyl 2-(1-nitrocyclopropyl)acetate?
The canonical SMILES for benzyl 2-(1-nitrocyclopropyl)acetate is O=C(CC1([N+](=O)[O-])CC1)OCc1ccccc1.
What is the InChIKey of benzyl 2-(1-nitrocyclopropyl)acetate?
The InChIKey is VXIQTMOPSSOESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4/c14-11(8-12(6-7-12)13(15)16)17-9-10-4-2-1-3-5-10/h1-5H,6-9H2.
What are the key properties of benzyl 2-(1-nitrocyclopropyl)acetate?
benzyl 2-(1-nitrocyclopropyl)acetate has a molecular weight of 235.24 g/mol, XLogP of 1.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(1-nitrocyclopropyl)acetate is sourced from PubChem (CID 121000461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).