C12H6Cl4N2 — CID 121000676
3-chloro-6-(trichloromethyl)pyrrolo[1,2-a]quinoxaline (PubChem CID 121000676) has the molecular formula C12H6Cl4N2 and a molecular weight of 320.01 g/mol. Its IUPAC name is 3-chloro-6-(trichloromethyl)pyrrolo[1,2-a]quinoxaline.
| Compound Name | 3-chloro-6-(trichloromethyl)pyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 121000676 |
| Molecular Formula | C12H6Cl4N2 |
| Molecular Weight | 320.01 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 3-chloro-6-(trichloromethyl)pyrrolo[1,2-a]quinoxaline |
| SMILES | Clc1ccn2c1cnc1c(C(Cl)(Cl)Cl)cccc12 |
| InChI | InChI=1S/C12H6Cl4N2/c13-8-4-5-18-9-3-1-2-7(12(14,15)16)11(9)17-6-10(8)18/h1-6H |
| InChIKey | QNBMXAHCKKAJEP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.01 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|