C12H16OS2 — CID 121001327
2-[3-(methoxymethyl)phenyl]-1,3-dithiane (PubChem CID 121001327) has the molecular formula C12H16OS2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-[3-(methoxymethyl)phenyl]-1,3-dithiane.
| Compound Name | 2-[3-(methoxymethyl)phenyl]-1,3-dithiane |
|---|---|
| PubChem CID | 121001327 |
| Molecular Formula | C12H16OS2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2-[3-(methoxymethyl)phenyl]-1,3-dithiane |
| SMILES | COCc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C12H16OS2/c1-13-9-10-4-2-5-11(8-10)12-14-6-3-7-15-12/h2,4-5,8,12H,3,6-7,9H2,1H3 |
| InChIKey | ILYOJATXICKFIL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |