About (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol
(7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol (PubChem CID 121001600) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol.
Molecular Properties
| Compound Name | (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol |
| PubChem CID | 121001600 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol |
| SMILES | CC(C)(C)[C@H]1CCC2(C[C@@H]1O)OCCO2 |
| InChI | InChI=1S/C12H22O3/c1-11(2,3)9-4-5-12(8-10(9)13)14-6-7-15-12/h9-10,13H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | DANGHOBVXDTABS-UWVGGRQHSA-N |
| XLogP | 1.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol?
The IUPAC name of (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol (CID 121001600) is (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol.
What is the SMILES notation for (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol?
The canonical SMILES for (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol is CC(C)(C)[C@H]1CCC2(C[C@@H]1O)OCCO2.
What is the InChIKey of (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol?
The InChIKey is DANGHOBVXDTABS-UWVGGRQHSA-N. The full InChI is InChI=1S/C12H22O3/c1-11(2,3)9-4-5-12(8-10(9)13)14-6-7-15-12/h9-10,13H,4-8H2,1-3H3/t9-,10-/m0/s1.
What are the key properties of (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol?
(7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol has a molecular weight of 214.30 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7S,8R)-8-tert-butyl-1,4-dioxaspiro[4.5]decan-7-ol is sourced from PubChem (CID 121001600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).