C12H12 — CID 121002324
(2Z,4Z,6Z)-9-cycloprop-2-en-1-ylbicyclo[6.1.0]nona-2,4,6-triene (PubChem CID 121002324) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is (2Z,4Z,6Z)-9-cycloprop-2-en-1-ylbicyclo[6.1.0]nona-2,4,6-triene.
| Compound Name | (2Z,4Z,6Z)-9-cycloprop-2-en-1-ylbicyclo[6.1.0]nona-2,4,6-triene |
|---|---|
| PubChem CID | 121002324 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (2Z,4Z,6Z)-9-cycloprop-2-en-1-ylbicyclo[6.1.0]nona-2,4,6-triene |
| SMILES | C1=CC1C1C2/C=C\C=C/C=C\C21 |
| InChI | InChI=1S/C12H12/c1-2-4-6-11-10(5-3-1)12(11)9-7-8-9/h1-12H/b2-1-,5-3-,6-4- |
| InChIKey | ACHYMEYHIWUFKC-XCADPSHZSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|