About 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one
5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one (PubChem CID 121002490) has the molecular formula C12H14N2O4
and a molecular weight of 250.25 g/mol. Its IUPAC name is 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one.
Molecular Properties
| Compound Name | 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one |
| PubChem CID | 121002490 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one |
| SMILES | [H]/N=C1\OC(c2cccc(OC)c2OC)C(=O)N1C |
| InChI | InChI=1S/C12H14N2O4/c1-14-11(15)10(18-12(14)13)7-5-4-6-8(16-2)9(7)17-3/h4-6,10,13H,1-3H3/b13-12- |
| InChIKey | GNPPQMLJELTSJU-SEYXRHQNSA-N |
| XLogP | 1.17 |
| TPSA | 71.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one?
The IUPAC name of 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one (CID 121002490) is 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one.
What is the SMILES notation for 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one?
The canonical SMILES for 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one is [H]/N=C1\OC(c2cccc(OC)c2OC)C(=O)N1C.
What is the InChIKey of 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one?
The InChIKey is GNPPQMLJELTSJU-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H14N2O4/c1-14-11(15)10(18-12(14)13)7-5-4-6-8(16-2)9(7)17-3/h4-6,10,13H,1-3H3/b13-12-.
What are the key properties of 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one?
5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one has a molecular weight of 250.25 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dimethoxyphenyl)-2-imino-3-methyl-1,3-oxazolidin-4-one is sourced from PubChem (CID 121002490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).