About (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate
(4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate (PubChem CID 121002900) has the molecular formula C12H12FNO3S
and a molecular weight of 269.30 g/mol. Its IUPAC name is (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate.
Molecular Properties
| Compound Name | (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate |
| PubChem CID | 121002900 |
| Molecular Formula | C12H12FNO3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate |
| SMILES | CC1(COC(=O)c2cccc(F)c2)COC(=S)N1 |
| InChI | InChI=1S/C12H12FNO3S/c1-12(7-17-11(18)14-12)6-16-10(15)8-3-2-4-9(13)5-8/h2-5H,6-7H2,1H3,(H,14,18) |
| InChIKey | DPLYVODPZLGCCG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate?
The IUPAC name of (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate (CID 121002900) is (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate.
What is the SMILES notation for (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate?
The canonical SMILES for (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate is CC1(COC(=O)c2cccc(F)c2)COC(=S)N1.
What is the InChIKey of (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate?
The InChIKey is DPLYVODPZLGCCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO3S/c1-12(7-17-11(18)14-12)6-16-10(15)8-3-2-4-9(13)5-8/h2-5H,6-7H2,1H3,(H,14,18).
What are the key properties of (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate?
(4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate has a molecular weight of 269.30 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2-sulfanylidene-1,3-oxazolidin-4-yl)methyl 3-fluorobenzoate is sourced from PubChem (CID 121002900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).