About 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine
1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine (PubChem CID 121003042) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine |
| PubChem CID | 121003042 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine |
| SMILES | CN(C)C(=C1C=CC=C1)N1CCOCC1 |
| InChI | InChI=1S/C12H18N2O/c1-13(2)12(11-5-3-4-6-11)14-7-9-15-10-8-14/h3-6H,7-10H2,1-2H3 |
| InChIKey | JKDGXWNZSDQLFE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine?
The IUPAC name of 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine (CID 121003042) is 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine is CN(C)C(=C1C=CC=C1)N1CCOCC1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine?
The InChIKey is JKDGXWNZSDQLFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-13(2)12(11-5-3-4-6-11)14-7-9-15-10-8-14/h3-6H,7-10H2,1-2H3.
What are the key properties of 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine?
1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine has a molecular weight of 206.29 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-ylidene-N,N-dimethyl-1-morpholin-4-ylmethanamine is sourced from PubChem (CID 121003042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).