About (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one
(1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one (PubChem CID 121003045) has the molecular formula C12H10F2O
and a molecular weight of 208.21 g/mol. Its IUPAC name is (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one.
Molecular Properties
| Compound Name | (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one |
| PubChem CID | 121003045 |
| Molecular Formula | C12H10F2O |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1CC[C@]2(c3cc(F)cc(F)c3)C[C@H]12 |
| InChI | InChI=1S/C12H10F2O/c13-8-3-7(4-9(14)5-8)12-2-1-11(15)10(12)6-12/h3-5,10H,1-2,6H2/t10-,12-/m1/s1 |
| InChIKey | JXPHJARTNNNVQB-ZYHUDNBSSA-N |
| XLogP | 2.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one?
The IUPAC name of (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one (CID 121003045) is (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one.
What is the SMILES notation for (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one?
The canonical SMILES for (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one is O=C1CC[C@]2(c3cc(F)cc(F)c3)C[C@H]12.
What is the InChIKey of (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one?
The InChIKey is JXPHJARTNNNVQB-ZYHUDNBSSA-N. The full InChI is InChI=1S/C12H10F2O/c13-8-3-7(4-9(14)5-8)12-2-1-11(15)10(12)6-12/h3-5,10H,1-2,6H2/t10-,12-/m1/s1.
What are the key properties of (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one?
(1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one has a molecular weight of 208.21 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-5-(3,5-difluorophenyl)bicyclo[3.1.0]hexan-2-one is sourced from PubChem (CID 121003045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).