C12H19Cl — CID 121003614
3-(1-chloroethyl)-1,2,3,4-tetramethyl-5-methylidenecyclopentene (PubChem CID 121003614) has the molecular formula C12H19Cl and a molecular weight of 198.74 g/mol. Its IUPAC name is 3-(1-chloroethyl)-1,2,3,4-tetramethyl-5-methylidenecyclopentene.
| Compound Name | 3-(1-chloroethyl)-1,2,3,4-tetramethyl-5-methylidenecyclopentene |
|---|---|
| PubChem CID | 121003614 |
| Molecular Formula | C12H19Cl |
| Molecular Weight | 198.74 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 3-(1-chloroethyl)-1,2,3,4-tetramethyl-5-methylidenecyclopentene |
| SMILES | C=C1C(C)=C(C)C(C)(C(C)Cl)C1C |
| InChI | InChI=1S/C12H19Cl/c1-7-8(2)10(4)12(6,9(7)3)11(5)13/h9,11H,1H2,2-6H3 |
| InChIKey | AMCXFSORRPASFF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|