C12H20INO2 — CID 121003776
tert-butyl N-[(2R,3E,5E)-6-iodo-2-methylhexa-3,5-dienyl]carbamate (PubChem CID 121003776) has the molecular formula C12H20INO2 and a molecular weight of 337.20 g/mol. Its IUPAC name is tert-butyl N-[(2R,3E,5E)-6-iodo-2-methylhexa-3,5-dienyl]carbamate.
| Compound Name | tert-butyl N-[(2R,3E,5E)-6-iodo-2-methylhexa-3,5-dienyl]carbamate |
|---|---|
| PubChem CID | 121003776 |
| Molecular Formula | C12H20INO2 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | tert-butyl N-[(2R,3E,5E)-6-iodo-2-methylhexa-3,5-dienyl]carbamate |
| SMILES | C[C@H](/C=C/C=C/I)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20INO2/c1-10(7-5-6-8-13)9-14-11(15)16-12(2,3)4/h5-8,10H,9H2,1-4H3,(H,14,15)/b7-5+,8-6+/t10-/m1/s1 |
| InChIKey | WDEOJIDBIXUJGD-DETQVXBVSA-N |
| XLogP | 3.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|