About (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone
(2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone (PubChem CID 121003906) has the molecular formula C12H7ClN2O2S
and a molecular weight of 278.72 g/mol. Its IUPAC name is (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone.
Molecular Properties
| Compound Name | (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone |
| PubChem CID | 121003906 |
| Molecular Formula | C12H7ClN2O2S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)c2nc(Cl)nc3ccsc23)o1 |
| InChI | InChI=1S/C12H7ClN2O2S/c1-6-2-3-8(17-6)10(16)9-11-7(4-5-18-11)14-12(13)15-9/h2-5H,1H3 |
| InChIKey | VVOWHANTYCDHTG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone?
The IUPAC name of (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone (CID 121003906) is (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone.
What is the SMILES notation for (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone?
The canonical SMILES for (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone is Cc1ccc(C(=O)c2nc(Cl)nc3ccsc23)o1.
What is the InChIKey of (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone?
The InChIKey is VVOWHANTYCDHTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClN2O2S/c1-6-2-3-8(17-6)10(16)9-11-7(4-5-18-11)14-12(13)15-9/h2-5H,1H3.
What are the key properties of (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone?
(2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone has a molecular weight of 278.72 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorothieno[3,2-d]pyrimidin-4-yl)-(5-methylfuran-2-yl)methanone is sourced from PubChem (CID 121003906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).